102-85-2 Tributyl phosphite
Ürün Adı |
Tributyl phosphite |
ingilizce adı |
Tributyl phosphite; Tri-n-butyl phosphite |
Moleküler Formülü |
C12H27O3P |
Molekül Ağırlığı |
250.3147 |
InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS kayıt numarası |
102-85-2 |
EINECS |
203-061-3 |
Moleküler Yapısı |
|
Ergime noktası |
-80℃ |
Kaynama noktası |
268.1°C at 760 mmHg |
Alevlenme noktası |
121.1°C |
Buhar basıncı |
0.013mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|