ChemNet > CAS > 10558-44-8 di2-thienylmethanone oxime
10558-44-8 di2-thienylmethanone oxime
| Ürün Adı |
di2-thienylmethanone oxime |
| ingilizce adı |
di2-thienylmethanone oxime; Bis(2-thienyl) ketoxime; Di-2-thienylmethanone oxime; dithiophen-2-ylmethanone oxime |
| Moleküler Formülü |
C9H7NOS2 |
| Molekül Ağırlığı |
209.288 |
| InChI |
InChI=1/C9H7NOS2/c11-10-9(7-3-1-5-12-7)8-4-2-6-13-8/h1-6,11H |
| CAS kayıt numarası |
10558-44-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.38g/cm3 |
| Ergime noktası |
125℃ |
| Kaynama noktası |
361.1°C at 760 mmHg |
| Kırılma indisi |
1.698 |
| Alevlenme noktası |
172.2°C |
| Buhar basıncı |
7.58E-06mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
