ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
| Ürün Adı |
ethyl (R)-(-)-mandelate |
| ingilizce adı |
ethyl (R)-(-)-mandelate; (-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| Moleküler Formülü |
C10H12O3 |
| Molekül Ağırlığı |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| CAS kayıt numarası |
10606-72-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.147g/cm3 |
| Ergime noktası |
33-34℃ |
| Kaynama noktası |
254°C at 760 mmHg |
| Kırılma indisi |
1.528 |
| Alevlenme noktası |
118.1°C |
| Buhar basıncı |
0.00918mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
