ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
Ürün Adı |
2,6-Dibromo-4-nitrotoluene |
ingilizce adı |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
Moleküler Formülü |
C7H5Br2NO2 |
Molekül Ağırlığı |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
CAS kayıt numarası |
110127-07-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.967g/cm3 |
Kaynama noktası |
320.4°C at 760 mmHg |
Kırılma indisi |
1.625 |
Alevlenme noktası |
147.6°C |
Buhar basıncı |
0.000598mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|