ChemNet > CAS > 1124-39-6 4-Ethylcatechol
1124-39-6 4-Ethylcatechol
| Ürün Adı |
4-Ethylcatechol |
| ingilizce adı |
4-Ethylcatechol; 3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
| Moleküler Formülü |
C8H10O2 |
| Molekül Ağırlığı |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| CAS kayıt numarası |
1124-39-6 |
| EINECS |
214-397-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.159g/cm3 |
| Kaynama noktası |
273.3°C at 760 mmHg |
| Kırılma indisi |
1.578 |
| Alevlenme noktası |
134.1°C |
| Buhar basıncı |
0.00346mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
