ChemNet > CAS > 114152-19-1 2,3,6-trifluorobenzyl alcohol
114152-19-1 2,3,6-trifluorobenzyl alcohol
Ürün Adı |
2,3,6-trifluorobenzyl alcohol |
ingilizce adı |
2,3,6-trifluorobenzyl alcohol; |
Moleküler Formülü |
C7H5F3O |
Molekül Ağırlığı |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
CAS kayıt numarası |
114152-19-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.398g/cm3 |
Ergime noktası |
43-45℃ |
Kaynama noktası |
187°C at 760 mmHg |
Kırılma indisi |
1.476 |
Alevlenme noktası |
80.8°C |
Buhar basıncı |
0.412mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|