ChemNet > CAS > 1205-06-7 4-Ethoxycarbonylphenyl isothiocyanate
1205-06-7 4-Ethoxycarbonylphenyl isothiocyanate
| Ürün Adı |
4-Ethoxycarbonylphenyl isothiocyanate |
| ingilizce adı |
4-Ethoxycarbonylphenyl isothiocyanate; 4-(Ethoxycarbonyl)phenyl isothiocyanate; Ethyl 4-isothiocyanatobenzoate; 4-Isothiocyanatobenzoic acid ethyl ester |
| Moleküler Formülü |
C10H9NO2S |
| Molekül Ağırlığı |
207.249 |
| InChI |
InChI=1/C10H9NO2S/c1-2-13-10(12)8-3-5-9(6-4-8)11-7-14/h3-6H,2H2,1H3 |
| CAS kayıt numarası |
1205-06-7 |
| EINECS |
214-880-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.14g/cm3 |
| Kaynama noktası |
327.5°C at 760 mmHg |
| Kırılma indisi |
1.558 |
| Alevlenme noktası |
151.9°C |
| Buhar basıncı |
0.000201mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
