ChemNet > CAS > 1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
| Ürün Adı |
1-(2-hydroxyphenyl)-3-phenyl-2-propenone |
| ingilizce adı |
1-(2-hydroxyphenyl)-3-phenyl-2-propenone; 2-Hydroxychalcone; Benzylidene(2-hydroxyacetophenone); 1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one; (2E)-1-(2-hydroxyphenyl)-3-phenylprop-2-en-1-one; 2'-Hydroxychalcone; 2'-HYDROXY BENZALACETOPHENONE; 2-Hydroxybenzalacetophenone |
| Moleküler Formülü |
C15H12O2 |
| Molekül Ağırlığı |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
| CAS kayıt numarası |
1214-47-7 |
| EINECS |
214-928-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.191g/cm3 |
| Ergime noktası |
88-92℃ |
| Kaynama noktası |
396.6°C at 760 mmHg |
| Kırılma indisi |
1.653 |
| Alevlenme noktası |
169.4°C |
| Buhar basıncı |
7.4E-07mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
