124-48-1 Chlorodibromomethane
Ürün Adı |
Chlorodibromomethane |
ingilizce adı |
Chlorodibromomethane; Dibromochloromethane |
Moleküler Formülü |
CHBr2Cl |
Molekül Ağırlığı |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
CAS kayıt numarası |
124-48-1 |
EINECS |
204-704-0 |
Moleküler Yapısı |
|
Yoğunluk |
2.504g/cm3 |
Ergime noktası |
-22℃ |
Kaynama noktası |
117.1°C at 760 mmHg |
Kırılma indisi |
1.561 |
Alevlenme noktası |
19.8°C |
Buhar basıncı |
21mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|