ChemNet > CAS > 126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
Ürün Adı |
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid |
ingilizce adı |
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid; |
Moleküler Formülü |
C8H4F2O4 |
Molekül Ağırlığı |
202.1118 |
InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
CAS kayıt numarası |
126120-85-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.66g/cm3 |
Kaynama noktası |
260.8°C at 760 mmHg |
Kırılma indisi |
1.561 |
Alevlenme noktası |
111.5°C |
Buhar basıncı |
0.0061mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|