ChemNet > CAS > 129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
129-94-2 2-(8-Chloro-1-naphthylthio)acetic acid
| Ürün Adı |
2-(8-Chloro-1-naphthylthio)acetic acid |
| ingilizce adı |
2-(8-Chloro-1-naphthylthio)acetic acid; 2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
| Moleküler Formülü |
C12H8ClO2S |
| Molekül Ağırlığı |
251.7093 |
| InChI |
InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
| CAS kayıt numarası |
129-94-2 |
| EINECS |
204-971-3 |
| Moleküler Yapısı |
|
| Ergime noktası |
155-157℃ |
| Kaynama noktası |
450.1°C at 760 mmHg |
| Alevlenme noktası |
226°C |
| Buhar basıncı |
6.9E-09mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
