ChemNet > CAS > 13029-09-9 2,2'-Dibromobiphenyl
13029-09-9 2,2'-Dibromobiphenyl
| Ürün Adı |
2,2'-Dibromobiphenyl |
| ingilizce adı |
2,2'-Dibromobiphenyl; 2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
| Moleküler Formülü |
C12H8Br2 |
| Molekül Ağırlığı |
311.9999 |
| InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| CAS kayıt numarası |
13029-09-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.667g/cm3 |
| Ergime noktası |
79℃ |
| Kaynama noktası |
332.9°C at 760 mmHg |
| Kırılma indisi |
1.625 |
| Alevlenme noktası |
180°C |
| Buhar basıncı |
0.000274mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
