ChemNet > CAS > 1323-42-8 hidroksioktadekanoik asit, gliserol ile monoester
1323-42-8 hidroksioktadekanoik asit, gliserol ile monoester
| Ürün Adı |
hidroksioktadekanoik asit, gliserol ile monoester |
| Eş anlamlı |
Gliseril hidroksistearat; Hidroksistearik asit, gliserollü monoester; Stearik asit, hidroksi-, gliserol ile monoester; Hidroksioktadekanoik asit, gliserol ile monoester; Oktadekanoik asit, hidroksi-, 1,2,3-propantriol ile monoester; 1,3-dihidroksipropan-2-il 2-hidroksioktadekanoat;
|
| ingilizce adı |
hydroxyoctadecanoic acid, monoester with glycerol;Glyceryl hydroxystearate; Hydroxystearic acid, monoester with glycerol; Stearic acid, hydroxy-, monoester with glycerol; Hydroxyoctadecanoic acid, monoester with glycerol; Octadecanoic acid, hydroxy-, monoester with 1,2,3-propanetriol; 1,3-dihydroxypropan-2-yl 2-hydroxyoctadecanoate |
| Moleküler Formülü |
C21H42O5 |
| Molekül Ağırlığı |
374.5552 |
| InChI |
InChI=1/C21H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)21(25)26-19(17-22)18-23/h19-20,22-24H,2-18H2,1H3 |
| CAS kayıt numarası |
1323-42-8 |
| EINECS |
215-355-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.007g/cm3 |
| Kaynama noktası |
520.5°C at 760 mmHg |
| Kırılma indisi |
1.479 |
| Alevlenme noktası |
168.9°C |
| Buhar basıncı |
5.21E-13mmHg at 25°C |
|