ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| Ürün Adı |
Difluoromandelicacid |
| ingilizce adı |
Difluoromandelicacid; 3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| Moleküler Formülü |
C8H6F2O3 |
| Molekül Ağırlığı |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS kayıt numarası |
132741-29-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.522g/cm3 |
| Ergime noktası |
92-94℃ |
| Kaynama noktası |
320.7°C at 760 mmHg |
| Kırılma indisi |
1.542 |
| Alevlenme noktası |
147.8°C |
| Buhar basıncı |
0.000129mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
