ChemNet > CAS > 132898-95-4 2,2'-bitiyofen-5-boronik asit
132898-95-4 2,2'-bitiyofen-5-boronik asit
Ürün Adı |
2,2'-bitiyofen-5-boronik asit |
Eş anlamlı |
2,2'-bitiyofen-5-ilboronik asit;
|
ingilizce adı |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
Moleküler Formülü |
C8H7BO2S2 |
Molekül Ağırlığı |
210.081 |
InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
CAS kayıt numarası |
132898-95-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.42g/cm3 |
Ergime noktası |
127℃ |
Kaynama noktası |
416.1°C at 760 mmHg |
Kırılma indisi |
1.658 |
Alevlenme noktası |
205.5°C |
Buhar basıncı |
1.14E-07mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|