ChemNet > CAS > 14064-83-6 4-Hidroksi-4'-nitrostilben
14064-83-6 4-Hidroksi-4'-nitrostilben
| Ürün Adı |
4-Hidroksi-4'-nitrostilben |
| Eş anlamlı |
; 4- [2- (Nitrofenil) etenil] fenol; 4- [2- (4-nitrofenil) etenil] fenol; 4- [(E) -2- (4-nitrofenil) etenil]fenol;
|
| ingilizce adı |
4-Hydroxy-4'-nitrostilbene; 4-[2-(Nitrophenyl)ethenyl]phenol; 4-[2-(4-nitrophenyl)ethenyl]phenol; 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| Moleküler Formülü |
C14H11NO3 |
| Molekül Ağırlığı |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| CAS kayıt numarası |
14064-83-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.318g/cm3 |
| Kaynama noktası |
389.8°C at 760 mmHg |
| Kırılma indisi |
1.717 |
| Alevlenme noktası |
164.5°C |
| Buhar basıncı |
1.23E-06mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
