ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
| Ürün Adı |
1-Methylthio-2-propanone |
| ingilizce adı |
1-Methylthio-2-propanone; 1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
| Moleküler Formülü |
C4H8OS |
| Molekül Ağırlığı |
104.1707 |
| InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
| CAS kayıt numarası |
14109-72-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.985g/cm3 |
| Kaynama noktası |
144°C at 760 mmHg |
| Kırılma indisi |
1.453 |
| Alevlenme noktası |
42.8°C |
| Buhar basıncı |
5.19mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
