ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
Ürün Adı |
2,3-difluorophenylacetonitrile |
ingilizce adı |
2,3-difluorophenylacetonitrile; 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
Moleküler Formülü |
C8H5F2N |
Molekül Ağırlığı |
153.1288 |
InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
CAS kayıt numarası |
145689-34-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.234g/cm3 |
Kaynama noktası |
216.9°C at 760 mmHg |
Kırılma indisi |
1.487 |
Alevlenme noktası |
85°C |
Buhar basıncı |
0.136mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|