ChemNet > CAS > 1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
| Ürün Adı |
2-bromo-1-(3-thienyl)-1-ethanone |
| ingilizce adı |
2-bromo-1-(3-thienyl)-1-ethanone;2-bromo-1-thiophen-3-ylethanone |
| Moleküler Formülü |
C6H5BrOS |
| Molekül Ağırlığı |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c7-3-6(8)5-1-2-9-4-5/h1-2,4H,3H2 |
| CAS kayıt numarası |
1468-82-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.658g/cm3 |
| Ergime noktası |
62℃ |
| Kaynama noktası |
247.5°C at 760 mmHg |
| Kırılma indisi |
1.601 |
| Alevlenme noktası |
103.5°C |
| Buhar basıncı |
0.0255mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
