ChemNet > CAS > 1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
Ürün Adı |
2-(1-Cyclohexenyl)cyclohexanone |
ingilizce adı |
2-(1-Cyclohexenyl)cyclohexanone;2-(1-cyclohexen-1-yl)-Cyclohexanone |
Moleküler Formülü |
C12H18O |
Molekül Ağırlığı |
178.2707 |
InChI |
InChI=1/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2/t11-/m1/s1 |
CAS kayıt numarası |
1502-22-3 |
EINECS |
216-120-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.022g/cm3 |
Kaynama noktası |
281.9°C at 760 mmHg |
Kırılma indisi |
1.521 |
Alevlenme noktası |
116.1°C |
Buhar basıncı |
0.00346mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|