ChemNet > CAS > 15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
| Ürün Adı |
2-(3-Methoxyphenyl)cyclohexanone |
| ingilizce adı |
2-(3-Methoxyphenyl)cyclohexanone;Cyclohexanone, 2-(3-methoxyphenyl)-; (2R)-2-(3-methoxyphenyl)cyclohexanone; (2S)-2-(3-methoxyphenyl)cyclohexanone |
| Moleküler Formülü |
C13H16O2 |
| Molekül Ağırlığı |
204.2649 |
| InChI |
InChI=1/C13H16O2/c1-15-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14/h4-6,9,12H,2-3,7-8H2,1H3/t12-/m0/s1 |
| CAS kayıt numarası |
15547-89-4 |
| EINECS |
239-602-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.068g/cm3 |
| Kaynama noktası |
332.6°C at 760 mmHg |
| Kırılma indisi |
1.528 |
| Alevlenme noktası |
147.8°C |
| Buhar basıncı |
0.000144mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
