ChemNet > CAS > 1585-17-7 2,4-Bis(chloromethyl)mesitylene
1585-17-7 2,4-Bis(chloromethyl)mesitylene
| Ürün Adı |
2,4-Bis(chloromethyl)mesitylene |
| ingilizce adı |
2,4-Bis(chloromethyl)mesitylene; 2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene; 2,4-Di(chloromethyl)-1,3,5-trimethylbenzene; 2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
| Moleküler Formülü |
C11H14Cl2 |
| Molekül Ağırlığı |
217.1349 |
| InChI |
InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
| CAS kayıt numarası |
1585-17-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.121g/cm3 |
| Ergime noktası |
104-105℃ |
| Kaynama noktası |
311.7°C at 760 mmHg |
| Kırılma indisi |
1.534 |
| Alevlenme noktası |
154.9°C |
| Buhar basıncı |
0.00102mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
