ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
| Ürün Adı |
4,4'-Biphenyldicarbonitrile |
| ingilizce adı |
4,4'-Biphenyldicarbonitrile; 4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
| Moleküler Formülü |
C14H8N2 |
| Molekül Ağırlığı |
204.2267 |
| InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
| CAS kayıt numarası |
1591-30-6 |
| EINECS |
216-468-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.2g/cm3 |
| Ergime noktası |
236-236℃ |
| Kaynama noktası |
403.5°C at 760 mmHg |
| Kırılma indisi |
1.631 |
| Alevlenme noktası |
199.2°C |
| Buhar basıncı |
1.02E-06mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/22:Harmful by inhalation and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
