ChemNet > CAS > 162607-17-2 5-bromo-2-thienylboronic acid
162607-17-2 5-bromo-2-thienylboronic acid
Ürün Adı |
5-bromo-2-thienylboronic acid |
ingilizce adı |
5-bromo-2-thienylboronic acid; 5-Bromothiophene-2-boronic acid; (5-bromothiophen-2-yl)boronic acid; 5-Bromo-2-thiopheneboronic acid |
Moleküler Formülü |
C4H4BBrO2S |
Molekül Ağırlığı |
206.8534 |
InChI |
InChI=1/C4H4BBrO2S/c6-4-2-1-3(9-4)5(7)8/h1-2,7-8H |
CAS kayıt numarası |
162607-17-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.87g/cm3 |
Ergime noktası |
130-135℃ |
Kaynama noktası |
342.3°C at 760 mmHg |
Kırılma indisi |
1.629 |
Alevlenme noktası |
160.8°C |
Buhar basıncı |
2.93E-05mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|