ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
Ürün Adı |
5-fluoro-2-methylphenylboronic acid |
ingilizce adı |
5-fluoro-2-methylphenylboronic acid; 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
Moleküler Formülü |
C7H8BFO2 |
Molekül Ağırlığı |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
CAS kayıt numarası |
163517-62-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.2g/cm3 |
Kaynama noktası |
287.7°C at 760 mmHg |
Kırılma indisi |
1.505 |
Alevlenme noktası |
127.8°C |
Buhar basıncı |
0.00113mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|