ChemNet > CAS > 16493-35-9 Undecyl methacrylate
16493-35-9 Undecyl methacrylate
| Ürün Adı |
Undecyl methacrylate |
| ingilizce adı |
Undecyl methacrylate;2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
| Moleküler Formülü |
C15H28O2 |
| Molekül Ağırlığı |
240.3816 |
| InChI |
InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| CAS kayıt numarası |
16493-35-9 |
| EINECS |
240-558-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.875g/cm3 |
| Kaynama noktası |
305.9°C at 760 mmHg |
| Kırılma indisi |
1.443 |
| Alevlenme noktası |
124.4°C |
| Buhar basıncı |
0.000797mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
