ChemNet > CAS > 1664-54-6 3-Aminophenylpropanoic Acid
1664-54-6 3-Aminophenylpropanoic Acid
| Ürün Adı |
3-Aminophenylpropanoic Acid |
| ingilizce adı |
3-Aminophenylpropanoic Acid; 3-(3-Aminophenyl)propionic acid; 3-amino-3-phenylpropanoic acid; 3-(3-aminophenyl)propanoic acid |
| Moleküler Formülü |
C9H11NO2 |
| Molekül Ağırlığı |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) |
| CAS kayıt numarası |
1664-54-6 |
| EINECS |
210-371-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.217g/cm3 |
| Kaynama noktası |
356.2°C at 760 mmHg |
| Kırılma indisi |
1.597 |
| Alevlenme noktası |
169.2°C |
| Buhar basıncı |
1.09E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
