ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| Ürün Adı |
5-Nitrothiophene-2-carbonitrile |
| ingilizce adı |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
| Moleküler Formülü |
C5H2N2O2S |
| Molekül Ağırlığı |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS kayıt numarası |
16689-02-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.5g/cm3 |
| Kaynama noktası |
273.9°C at 760 mmHg |
| Kırılma indisi |
1.611 |
| Alevlenme noktası |
119.4°C |
| Buhar basıncı |
0.00558mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
