ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
| Ürün Adı |
2-(Phenylthio)thiophene |
| ingilizce adı |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
| Moleküler Formülü |
C10H8S2 |
| Molekül Ağırlığı |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
| CAS kayıt numarası |
16718-12-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.24g/cm3 |
| Kaynama noktası |
304.7°C at 760 mmHg |
| Kırılma indisi |
1.667 |
| Alevlenme noktası |
138.1°C |
| Buhar basıncı |
0.00155mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
