ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| Ürün Adı |
3-Fluoro-4-methylbenzonitrile |
| ingilizce adı |
3-Fluoro-4-methylbenzonitrile; 4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| Moleküler Formülü |
C8H6FN |
| Molekül Ağırlığı |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| CAS kayıt numarası |
170572-49-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.117g/cm3 |
| Ergime noktası |
48-50℃ |
| Kaynama noktası |
215.069°C at 760 mmHg |
| Kırılma indisi |
1.508 |
| Alevlenme noktası |
90.3°C |
| Buhar basıncı |
0.151mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
