ChemNet > CAS > 17277-58-6 Methyl (phenylthio)acetate
17277-58-6 Methyl (phenylthio)acetate
| Ürün Adı |
Methyl (phenylthio)acetate |
| ingilizce adı |
Methyl (phenylthio)acetate; Methyl (phenylmercapto)acetate~(Phenylthio)acetic acid methyl ester; methyl (phenylsulfanyl)acetate |
| Moleküler Formülü |
C9H10O2S |
| Molekül Ağırlığı |
182.2395 |
| InChI |
InChI=1/C9H10O2S/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| CAS kayıt numarası |
17277-58-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.16g/cm3 |
| Kaynama noktası |
259.3°C at 760 mmHg |
| Kırılma indisi |
1.556 |
| Alevlenme noktası |
115.3°C |
| Buhar basıncı |
0.013mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
