ChemNet > CAS > 17362-17-3 3-(4-Hydroxyphenyl)propionitrile
17362-17-3 3-(4-Hydroxyphenyl)propionitrile
| Ürün Adı |
3-(4-Hydroxyphenyl)propionitrile |
| ingilizce adı |
3-(4-Hydroxyphenyl)propionitrile; 3-(4-Hydroxyphenyl)-propionitrile; Hydrocinnamonitrile, p-hydroxy-; Benzenepropanenitrile, 4-hydroxy-; beta-(4-Hydroxyphenyl)propionitrile; Hydrocinnamonitrile,p-hydroxy-; 3-(4-HYDROXYPHENYL)PROPANENITRILE; 3-(P-HYDROXYPHENYL) PROPIONITRILE; 4-HYDROXYHYDROCINNAMONITRILE; 4-HYDROXYPHENYLPROPIONITRILE |
| Moleküler Formülü |
C9H9NO |
| Molekül Ağırlığı |
147.1739 |
| InChI |
InChI=1/C9H9NO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2H2 |
| CAS kayıt numarası |
17362-17-3 |
| EINECS |
241-393-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.127g/cm3 |
| Kaynama noktası |
344°C at 760 mmHg |
| Kırılma indisi |
1.56 |
| Alevlenme noktası |
161.8°C |
| Buhar basıncı |
3.42E-05mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
