ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
Ürün Adı |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
ingilizce adı |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one;3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
Moleküler Formülü |
C8H11ClO |
Molekül Ağırlığı |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
CAS kayıt numarası |
17530-69-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.09g/cm3 |
Kaynama noktası |
217.7°C at 760 mmHg |
Kırılma indisi |
1.488 |
Alevlenme noktası |
104.8°C |
Buhar basıncı |
0.131mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|