ChemNet > CAS > 17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
| Ürün Adı |
2-(4-Chlorophenyl)ethyl isothiocyanate |
| ingilizce adı |
2-(4-Chlorophenyl)ethyl isothiocyanate; 2-(4-Chlorophenethyl) isothiocyanate; 1-chloro-4-(2-isothiocyanatoethyl)benzene |
| Moleküler Formülü |
C9H8ClNS |
| Molekül Ağırlığı |
197.6845 |
| InChI |
InChI=1/C9H8ClNS/c10-9-3-1-8(2-4-9)5-6-11-7-12/h1-4H,5-6H2 |
| CAS kayıt numarası |
17608-10-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.15g/cm3 |
| Kaynama noktası |
311°C at 760 mmHg |
| Kırılma indisi |
1.572 |
| Alevlenme noktası |
141.9°C |
| Buhar basıncı |
0.00106mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
