ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| Ürün Adı |
Methyl 2-methoxypropionate |
| ingilizce adı |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| Moleküler Formülü |
C5H10O3 |
| Molekül Ağırlığı |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| CAS kayıt numarası |
17639-76-8 |
| EINECS |
241-622-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.973g/cm3 |
| Kaynama noktası |
136.2°C at 760 mmHg |
| Kırılma indisi |
1.389 |
| Alevlenme noktası |
40.6°C |
| Buhar basıncı |
7.45mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
