1766-76-3 decafluorobenzhydrol
Ürün Adı |
decafluorobenzhydrol |
ingilizce adı |
decafluorobenzhydrol; Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
Moleküler Formülü |
C13H2F10O |
Molekül Ağırlığı |
364.1384 |
InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
CAS kayıt numarası |
1766-76-3 |
EINECS |
217-185-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.74g/cm3 |
Ergime noktası |
76-80℃ |
Kaynama noktası |
265.2°C at 760 mmHg |
Kırılma indisi |
1.457 |
Alevlenme noktası |
114.2°C |
Buhar basıncı |
0.00464mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|