ChemNet > CAS > 177842-14-7 4-(difluoromethoxy)benzylamine
177842-14-7 4-(difluoromethoxy)benzylamine
| Ürün Adı |
4-(difluoromethoxy)benzylamine |
| ingilizce adı |
4-(difluoromethoxy)benzylamine;1-[4-(difluoromethoxy)phenyl]methanamine |
| Moleküler Formülü |
C8H9F2NO |
| Molekül Ağırlığı |
173.16 |
| InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2 |
| CAS kayıt numarası |
177842-14-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.196g/cm3 |
| Kaynama noktası |
227.3°C at 760 mmHg |
| Kırılma indisi |
1.487 |
| Alevlenme noktası |
91.3°C |
| Buhar basıncı |
0.0781mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
