ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
Ürün Adı |
2,4,6-Trifluorobenzeneboronic acid |
ingilizce adı |
2,4,6-Trifluorobenzeneboronic acid; 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
Moleküler Formülü |
C6H4BF3O2 |
Molekül Ağırlığı |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
CAS kayıt numarası |
182482-25-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.44g/cm3 |
Ergime noktası |
228-235℃ |
Kaynama noktası |
266°C at 760 mmHg |
Kırılma indisi |
1.465 |
Alevlenme noktası |
114.6°C |
Buhar basıncı |
0.00444mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|