ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
| Ürün Adı |
2,3-Dimethylbenzeneboronic acid |
| ingilizce adı |
2,3-Dimethylbenzeneboronic acid; 2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
| Moleküler Formülü |
C8H11BO2 |
| Molekül Ağırlığı |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
| CAS kayıt numarası |
183158-34-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.07g/cm3 |
| Ergime noktası |
174-180℃ |
| Kaynama noktası |
312.6°C at 760 mmHg |
| Kırılma indisi |
1.523 |
| Alevlenme noktası |
142.8°C |
| Buhar basıncı |
0.000224mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
