ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
Ürün Adı |
Methyl 3-methoxyphenylacetate |
ingilizce adı |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
Moleküler Formülü |
C10H12O3 |
Molekül Ağırlığı |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
CAS kayıt numarası |
18927-05-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.083g/cm3 |
Kaynama noktası |
254°C at 760 mmHg |
Kırılma indisi |
1.499 |
Alevlenme noktası |
100.2°C |
Buhar basıncı |
0.0176mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|