ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
| Ürün Adı |
2,3,6-trifluorobenzoyl chloride |
| ingilizce adı |
2,3,6-trifluorobenzoyl chloride; Trifluorobenzoylchloride |
| Moleküler Formülü |
C7H2ClF3O |
| Molekül Ağırlığı |
194.5384 |
| InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
| CAS kayıt numarası |
189807-20-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.514g/cm3 |
| Kaynama noktası |
180.1°C at 760 mmHg |
| Kırılma indisi |
1.479 |
| Alevlenme noktası |
59°C |
| Buhar basıncı |
0.913mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
