ChemNet > CAS > 19547-88-7 N,S-diacetyl-L-cysteine methyl ester
19547-88-7 N,S-diacetyl-L-cysteine methyl ester
| Ürün Adı |
N,S-diacetyl-L-cysteine methyl ester |
| ingilizce adı |
N,S-diacetyl-L-cysteine methyl ester;N,S-Diacetylcysteine methyl ester; Methyl N,S-diacetyl-L-cysteinate |
| Moleküler Formülü |
C8H13NO4S |
| Molekül Ağırlığı |
219.2581 |
| InChI |
InChI=1/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1 |
| CAS kayıt numarası |
19547-88-7 |
| EINECS |
243-146-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.208g/cm3 |
| Ergime noktası |
97-100℃ |
| Kaynama noktası |
379.4°C at 760 mmHg |
| Kırılma indisi |
1.49 |
| Alevlenme noktası |
183.3°C |
| Buhar basıncı |
5.85E-06mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
