ChemNet > CAS > 19819-98-8 2-Methylphenethyl alcohol
19819-98-8 2-Methylphenethyl alcohol
Ürün Adı |
2-Methylphenethyl alcohol |
ingilizce adı |
2-Methylphenethyl alcohol; 2-o-tolylethanol; 2-(2-Methylphenyl)ethanol |
Moleküler Formülü |
C9H12O |
Molekül Ağırlığı |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS kayıt numarası |
19819-98-8 |
EINECS |
243-349-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.001g/cm3 |
Kaynama noktası |
243.5°C at 760 mmHg |
Kırılma indisi |
1.532 |
Alevlenme noktası |
108.3°C |
Buhar basıncı |
0.0172mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|