ChemNet > CAS > 2001-29-8 benzyl 4-brornophenyl ketone
2001-29-8 benzyl 4-brornophenyl ketone
| Ürün Adı |
benzyl 4-brornophenyl ketone |
| ingilizce adı |
benzyl 4-brornophenyl ketone; 4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
| Moleküler Formülü |
C14H11BrO |
| Molekül Ağırlığı |
275.1405 |
| InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| CAS kayıt numarası |
2001-29-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.39g/cm3 |
| Ergime noktası |
112-116℃ |
| Kaynama noktası |
383.2°C at 760 mmHg |
| Kırılma indisi |
1.608 |
| Alevlenme noktası |
84.6°C |
| Buhar basıncı |
4.47E-06mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
