ChemNet > CAS > 2142-70-3 2-Iodoacetophenone
2142-70-3 2-Iodoacetophenone
Ürün Adı |
2-Iodoacetophenone |
ingilizce adı |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
Moleküler Formülü |
C8H7IO |
Molekül Ağırlığı |
246.045 |
InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
CAS kayıt numarası |
2142-70-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.72g/cm3 |
Kaynama noktası |
268.2°C at 760 mmHg |
Kırılma indisi |
1.603 |
Alevlenme noktası |
116°C |
Buhar basıncı |
0.00779mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|