ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
| Ürün Adı |
3-Cyclohexene-1,1-dimethanol |
| ingilizce adı |
3-Cyclohexene-1,1-dimethanol; 4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
| Moleküler Formülü |
C8H14O2 |
| Molekül Ağırlığı |
142.1956 |
| InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
| CAS kayıt numarası |
2160-94-3 |
| EINECS |
218-481-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.05g/cm3 |
| Ergime noktası |
88-92℃ |
| Kaynama noktası |
231.2°C at 760 mmHg |
| Kırılma indisi |
1.497 |
| Alevlenme noktası |
105°C |
| Buhar basıncı |
0.0119mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
