ChemNet > CAS > 216394-07-9 (1S,2S)-(+)-2-Benzyloxycyclohexylamine
216394-07-9 (1S,2S)-(+)-2-Benzyloxycyclohexylamine
| Ürün Adı |
(1S,2S)-(+)-2-Benzyloxycyclohexylamine |
| ingilizce adı |
(1S,2S)-(+)-2-Benzyloxycyclohexylamine; (1S,2S)-(+)-1-Amino-2-benzyloxycyclohexane~(1S-trans)-(+)-2-(Phenylmethoxy)cyclohexanamine; (1S-trans)-2-(Phenylmethoxy)cyclohexaneamine; (1S,2S)-2-(benzyloxy)cyclohexanamine |
| Moleküler Formülü |
C13H19NO |
| Molekül Ağırlığı |
205.2961 |
| InChI |
InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m0/s1 |
| CAS kayıt numarası |
216394-07-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.039g/cm3 |
| Kaynama noktası |
306.148°C at 760 mmHg |
| Kırılma indisi |
1.545 |
| Alevlenme noktası |
133.224°C |
| Buhar basıncı |
0.001mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
