ChemNet > CAS > 2184-88-5 4-Kloro-alfa-metilfenilasetonitril
2184-88-5 4-Kloro-alfa-metilfenilasetonitril
Ürün Adı |
4-Kloro-alfa-metilfenilasetonitril |
Eş anlamlı |
; 2- (p-Klorofenil) propionitril; 2- (4-klorofenil) propanitril;
|
ingilizce adı |
4-Chloro-alpha-methylphenylacetonitrile; 2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
Moleküler Formülü |
C9H8ClN |
Molekül Ağırlığı |
165.6195 |
InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
CAS kayıt numarası |
2184-88-5 |
EINECS |
218-569-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.143g/cm3 |
Kaynama noktası |
260.3°C at 760 mmHg |
Kırılma indisi |
1.537 |
Alevlenme noktası |
104°C |
Buhar basıncı |
0.0123mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|