ChemNet > CAS > 220141-72-0 3,4,5-trifluorobenzyl bromide
220141-72-0 3,4,5-trifluorobenzyl bromide
| Ürün Adı |
3,4,5-trifluorobenzyl bromide |
| ingilizce adı |
3,4,5-trifluorobenzyl bromide; alpha-Bromo-3,4,5-trifluorotoluene; 5-(bromomethyl)-1,2,3-trifluorobenzene |
| Moleküler Formülü |
C7H4BrF3 |
| Molekül Ağırlığı |
225.0059 |
| InChI |
InChI=1/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2 |
| CAS kayıt numarası |
220141-72-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.71g/cm3 |
| Kaynama noktası |
188.4°C at 760 mmHg |
| Kırılma indisi |
1.502 |
| Alevlenme noktası |
75.1°C |
| Buhar basıncı |
0.827mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
