ChemNet > CAS > 220227-37-2 3,4,5-trifluorobenzyl alcohol
220227-37-2 3,4,5-trifluorobenzyl alcohol
| Ürün Adı |
3,4,5-trifluorobenzyl alcohol |
| ingilizce adı |
3,4,5-trifluorobenzyl alcohol; 3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
| Moleküler Formülü |
C7H5F3O |
| Molekül Ağırlığı |
162.1092 |
| InChI |
InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
| CAS kayıt numarası |
220227-37-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.398g/cm3 |
| Kaynama noktası |
192.1°C at 760 mmHg |
| Kırılma indisi |
1.476 |
| Alevlenme noktası |
83°C |
| Buhar basıncı |
0.313mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
